C17H18ClN3OS — CID 2197758
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone (PubChem CID 2197758) has the molecular formula C17H18ClN3OS and a molecular weight of 347.87 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 2197758 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone |
| SMILES | O=C(CSc1ccccn1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H18ClN3OS/c18-14-4-3-5-15(12-14)20-8-10-21(11-9-20)17(22)13-23-16-6-1-2-7-19-16/h1-7,12H,8-11,13H2 |
| InChIKey | JNVCCIMUCXGAMA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |