C18H21N3O2S — CID 7753218
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone (PubChem CID 7753218) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 7753218 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-ylsulfanylethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CSc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-23-16-7-5-15(6-8-16)20-10-12-21(13-11-20)18(22)14-24-17-4-2-3-9-19-17/h2-9H,10-14H2,1H3 |
| InChIKey | WHCKYHPBTGMJMC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|