C28H28N4O2S — CID 46357691
2-(3-benzylquinoxalin-2-yl)sulfanyl-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 46357691) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-(3-benzylquinoxalin-2-yl)sulfanyl-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-benzylquinoxalin-2-yl)sulfanyl-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46357691 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-(3-benzylquinoxalin-2-yl)sulfanyl-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CSc3nc4ccccc4nc3Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H28N4O2S/c1-34-23-13-11-22(12-14-23)31-15-17-32(18-16-31)27(33)20-35-28-26(19-21-7-3-2-4-8-21)29-24-9-5-6-10-25(24)30-28/h2-14H,15-20H2,1H3 |
| InChIKey | WAVQEVYJVUPZNR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|