C25H29N3O2S — CID 1176183
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,5,8-trimethylquinolin-2-yl)sulfanylethanone (PubChem CID 1176183) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,5,8-trimethylquinolin-2-yl)sulfanylethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,5,8-trimethylquinolin-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 1176183 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,5,8-trimethylquinolin-2-yl)sulfanylethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CSc3nc4c(C)ccc(C)c4cc3C)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O2S/c1-17-5-6-18(2)24-22(17)15-19(3)25(26-24)31-16-23(29)28-13-11-27(12-14-28)20-7-9-21(30-4)10-8-20/h5-10,15H,11-14,16H2,1-4H3 |
| InChIKey | WFOQRPJLZZPXOO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|