C19H19Cl2N5O2S — CID 31131405
2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 31131405) has the molecular formula C19H19Cl2N5O2S and a molecular weight of 452.37 g/mol. Its IUPAC name is 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 31131405 |
| Molecular Formula | C19H19Cl2N5O2S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CSc3nnc4c(Cl)cc(Cl)cn34)CC2)cc1 |
| InChI | InChI=1S/C19H19Cl2N5O2S/c1-28-15-4-2-14(3-5-15)24-6-8-25(9-7-24)17(27)12-29-19-23-22-18-16(21)10-13(20)11-26(18)19/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | WXTUNKBMTKLANQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|