C21H26ClN5O2S — CID 5224411
2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone (PubChem CID 5224411) has the molecular formula C21H26ClN5O2S and a molecular weight of 447.99 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 5224411 |
| Molecular Formula | C21H26ClN5O2S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-1-pyrrolidin-1-ylethanone |
| SMILES | COc1ccc(N2CCN(c3cc(Cl)nc(SCC(=O)N4CCCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H26ClN5O2S/c1-29-17-6-4-16(5-7-17)25-10-12-26(13-11-25)19-14-18(22)23-21(24-19)30-15-20(28)27-8-2-3-9-27/h4-7,14H,2-3,8-13,15H2,1H3 |
| InChIKey | OYCJXFGIFOJUJS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|