C26H37ClN6O2S — CID 3269136
2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide (PubChem CID 3269136) has the molecular formula C26H37ClN6O2S and a molecular weight of 533.14 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 3269136 |
| Molecular Formula | C26H37ClN6O2S |
| Molecular Weight | 533.14 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide |
| SMILES | COc1ccc(N2CCN(c3cc(Cl)nc(SCC(=O)NCCCN4CCCCC4C)n3)CC2)cc1 |
| InChI | InChI=1S/C26H37ClN6O2S/c1-20-6-3-4-12-31(20)13-5-11-28-25(34)19-36-26-29-23(27)18-24(30-26)33-16-14-32(15-17-33)21-7-9-22(35-2)10-8-21/h7-10,18,20H,3-6,11-17,19H2,1-2H3,(H,28,34) |
| InChIKey | VJIIFCWJSNGNIU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|