C19H30ClN5OS — CID 42753873
2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide (PubChem CID 42753873) has the molecular formula C19H30ClN5OS and a molecular weight of 412.00 g/mol. Its IUPAC name is 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 42753873 |
| Molecular Formula | C19H30ClN5OS |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)sulfanyl-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide |
| SMILES | CC1CCCCN1CCCNC(=O)CSc1nc(Cl)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H30ClN5OS/c1-15-7-2-3-9-24(15)12-6-8-21-18(26)14-27-19-22-16(20)13-17(23-19)25-10-4-5-11-25/h13,15H,2-12,14H2,1H3,(H,21,26) |
| InChIKey | INSRJMHGNGUWFC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|