C17H24ClN5O3S — CID 5023052
2-[4-chloro-6-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide (PubChem CID 5023052) has the molecular formula C17H24ClN5O3S and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-chloro-6-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 5023052 |
| Molecular Formula | C17H24ClN5O3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[4-chloro-6-[4-(cyclopropanecarbonyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)C3CC3)CC2)n1 |
| InChI | InChI=1S/C17H24ClN5O3S/c1-26-9-4-19-15(24)11-27-17-20-13(18)10-14(21-17)22-5-7-23(8-6-22)16(25)12-2-3-12/h10,12H,2-9,11H2,1H3,(H,19,24) |
| InChIKey | VXVHUCAFABCCTM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|