C16H24ClN5O3S — CID 7400270
2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide (PubChem CID 7400270) has the molecular formula C16H24ClN5O3S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7400270 |
| Molecular Formula | C16H24ClN5O3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(C)=O)[C@H](C)C2)n1 |
| InChI | InChI=1S/C16H24ClN5O3S/c1-11-9-21(5-6-22(11)12(2)23)14-8-13(17)19-16(20-14)26-10-15(24)18-4-7-25-3/h8,11H,4-7,9-10H2,1-3H3,(H,18,24)/t11-/m1/s1 |
| InChIKey | SFTJYIUUBCFKSQ-LLVKDONJSA-N |
| XLogP | 1.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|