C18H28ClN5O2S — CID 3969753
2-[4-(4-acetyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide (PubChem CID 3969753) has the molecular formula C18H28ClN5O2S and a molecular weight of 413.98 g/mol. Its IUPAC name is 2-[4-(4-acetyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide.
| Compound Name | 2-[4-(4-acetyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide |
|---|---|
| PubChem CID | 3969753 |
| Molecular Formula | C18H28ClN5O2S |
| Molecular Weight | 413.98 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[4-(4-acetyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(C)=O)C(C)C2)n1 |
| InChI | InChI=1S/C18H28ClN5O2S/c1-4-5-6-7-20-17(26)12-27-18-21-15(19)10-16(22-18)23-8-9-24(14(3)25)13(2)11-23/h10,13H,4-9,11-12H2,1-3H3,(H,20,26) |
| InChIKey | SCZIRWLVGWFRCG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.98 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|