C20H32ClN5O2S — CID 4270270
2-[4-(4-butanoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide (PubChem CID 4270270) has the molecular formula C20H32ClN5O2S and a molecular weight of 442.03 g/mol. Its IUPAC name is 2-[4-(4-butanoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide.
| Compound Name | 2-[4-(4-butanoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide |
|---|---|
| PubChem CID | 4270270 |
| Molecular Formula | C20H32ClN5O2S |
| Molecular Weight | 442.03 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 2-[4-(4-butanoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)CCC)C(C)C2)n1 |
| InChI | InChI=1S/C20H32ClN5O2S/c1-4-6-7-9-22-18(27)14-29-20-23-16(21)12-17(24-20)25-10-11-26(15(3)13-25)19(28)8-5-2/h12,15H,4-11,13-14H2,1-3H3,(H,22,27) |
| InChIKey | DADGDTYUWGNQJE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.03 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|