C25H34ClN5O2S — CID 42662786
2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide (PubChem CID 42662786) has the molecular formula C25H34ClN5O2S and a molecular weight of 504.10 g/mol. Its IUPAC name is 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 42662786 |
| Molecular Formula | C25H34ClN5O2S |
| Molecular Weight | 504.10 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)Nc3ccc(C)c(C)c3)n2)CC1C |
| InChI | InChI=1S/C25H34ClN5O2S/c1-5-6-7-8-24(33)31-12-11-30(15-19(31)4)22-14-21(26)28-25(29-22)34-16-23(32)27-20-10-9-17(2)18(3)13-20/h9-10,13-14,19H,5-8,11-12,15-16H2,1-4H3,(H,27,32) |
| InChIKey | TTZQMGSBTDWBJA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.10 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|