C23H36ClN5O2S — CID 3479222
2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclohexylacetamide (PubChem CID 3479222) has the molecular formula C23H36ClN5O2S and a molecular weight of 482.09 g/mol. Its IUPAC name is 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclohexylacetamide.
| Compound Name | 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 3479222 |
| Molecular Formula | C23H36ClN5O2S |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclohexylacetamide |
| SMILES | CCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)NC3CCCCC3)n2)CC1C |
| InChI | InChI=1S/C23H36ClN5O2S/c1-3-4-6-11-22(31)29-13-12-28(15-17(29)2)20-14-19(24)26-23(27-20)32-16-21(30)25-18-9-7-5-8-10-18/h14,17-18H,3-13,15-16H2,1-2H3,(H,25,30) |
| InChIKey | GROQVVKSIFRDGL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|