C24H31ClFN5O2S — CID 5031625
2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 5031625) has the molecular formula C24H31ClFN5O2S and a molecular weight of 508.06 g/mol. Its IUPAC name is 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 5031625 |
| Molecular Formula | C24H31ClFN5O2S |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[4-chloro-6-(4-hexanoyl-3-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)NCc3ccc(F)cc3)n2)CC1C |
| InChI | InChI=1S/C24H31ClFN5O2S/c1-3-4-5-6-23(33)31-12-11-30(15-17(31)2)21-13-20(25)28-24(29-21)34-16-22(32)27-14-18-7-9-19(26)10-8-18/h7-10,13,17H,3-6,11-12,14-16H2,1-2H3,(H,27,32) |
| InChIKey | GESBJTRTENFZHM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|