C29H42ClN5O4S — CID 4285305
2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 4285305) has the molecular formula C29H42ClN5O4S and a molecular weight of 592.21 g/mol. Its IUPAC name is 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4285305 |
| Molecular Formula | C29H42ClN5O4S |
| Molecular Weight | 592.21 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | CCCCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)NCCc3ccc(OC)c(OC)c3)n2)CC1C |
| InChI | InChI=1S/C29H42ClN5O4S/c1-5-6-7-8-9-10-28(37)35-16-15-34(19-21(35)2)26-18-25(30)32-29(33-26)40-20-27(36)31-14-13-22-11-12-23(38-3)24(17-22)39-4/h11-12,17-18,21H,5-10,13-16,19-20H2,1-4H3,(H,31,36) |
| InChIKey | UHTZUIJSHXMDCO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.21 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|