C24H32ClN5O3S — CID 3974107
2-[4-chloro-6-[4-(3-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-pentylacetamide (PubChem CID 3974107) has the molecular formula C24H32ClN5O3S and a molecular weight of 506.07 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(3-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-pentylacetamide.
| Compound Name | 2-[4-chloro-6-[4-(3-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-pentylacetamide |
|---|---|
| PubChem CID | 3974107 |
| Molecular Formula | C24H32ClN5O3S |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-[4-chloro-6-[4-(3-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)c3cccc(OC)c3)C(C)C2)n1 |
| InChI | InChI=1S/C24H32ClN5O3S/c1-4-5-6-10-26-22(31)16-34-24-27-20(25)14-21(28-24)29-11-12-30(17(2)15-29)23(32)18-8-7-9-19(13-18)33-3/h7-9,13-14,17H,4-6,10-12,15-16H2,1-3H3,(H,26,31) |
| InChIKey | UQBLSNBXMYMZPZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|