C23H32ClN5O2S — CID 4214880
2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-hexylacetamide (PubChem CID 4214880) has the molecular formula C23H32ClN5O2S and a molecular weight of 478.06 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-hexylacetamide.
| Compound Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-hexylacetamide |
|---|---|
| PubChem CID | 4214880 |
| Molecular Formula | C23H32ClN5O2S |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CSc1nc(Cl)cc(N2CCN(c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C23H32ClN5O2S/c1-3-4-5-6-11-25-22(30)17-32-23-26-20(24)16-21(27-23)29-14-12-28(13-15-29)18-7-9-19(31-2)10-8-18/h7-10,16H,3-6,11-15,17H2,1-2H3,(H,25,30) |
| InChIKey | AHJAILZHJHRRDS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|