C22H30Cl2N6OS — CID 3956738
N-(6-aminohexyl)-2-[4-chloro-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide (PubChem CID 3956738) has the molecular formula C22H30Cl2N6OS and a molecular weight of 497.50 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-[4-chloro-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(6-aminohexyl)-2-[4-chloro-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3956738 |
| Molecular Formula | C22H30Cl2N6OS |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-(6-aminohexyl)-2-[4-chloro-6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide |
| SMILES | NCCCCCCNC(=O)CSc1nc(Cl)cc(N2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C22H30Cl2N6OS/c23-17-6-5-7-18(14-17)29-10-12-30(13-11-29)20-15-19(24)27-22(28-20)32-16-21(31)26-9-4-2-1-3-8-25/h5-7,14-15H,1-4,8-13,16,25H2,(H,26,31) |
| InChIKey | YCDGHQFPJOCDDP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|