C23H25ClN6O2S — CID 42764661
2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 42764661) has the molecular formula C23H25ClN6O2S and a molecular weight of 485.01 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42764661 |
| Molecular Formula | C23H25ClN6O2S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | COc1ccc(N2CCN(c3cc(Cl)nc(SCC(=O)NCc4ccccn4)n3)CC2)cc1 |
| InChI | InChI=1S/C23H25ClN6O2S/c1-32-19-7-5-18(6-8-19)29-10-12-30(13-11-29)21-14-20(24)27-23(28-21)33-16-22(31)26-15-17-4-2-3-9-25-17/h2-9,14H,10-13,15-16H2,1H3,(H,26,31) |
| InChIKey | ATSAPWLANSRARY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|