C21H28ClN5O2S — CID 5224413
2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N,N-diethylacetamide (PubChem CID 5224413) has the molecular formula C21H28ClN5O2S and a molecular weight of 450.01 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 5224413 |
| Molecular Formula | C21H28ClN5O2S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-[4-chloro-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc(Cl)cc(N2CCN(c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C21H28ClN5O2S/c1-4-25(5-2)20(28)15-30-21-23-18(22)14-19(24-21)27-12-10-26(11-13-27)16-6-8-17(29-3)9-7-16/h6-9,14H,4-5,10-13,15H2,1-3H3 |
| InChIKey | DJOXVCKRZYLSKE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|