C28H39ClN6O3S — CID 42761556
1-[4-[6-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one (PubChem CID 42761556) has the molecular formula C28H39ClN6O3S and a molecular weight of 575.18 g/mol. Its IUPAC name is 1-[4-[6-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[6-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 42761556 |
| Molecular Formula | C28H39ClN6O3S |
| Molecular Weight | 575.18 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 1-[4-[6-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)N3CCN(c4ccc(OC)cc4)CC3)n2)CC1C |
| InChI | InChI=1S/C28H39ClN6O3S/c1-4-5-6-7-26(36)35-17-16-34(19-21(35)2)25-18-24(29)30-28(31-25)39-20-27(37)33-14-12-32(13-15-33)22-8-10-23(38-3)11-9-22/h8-11,18,21H,4-7,12-17,19-20H2,1-3H3 |
| InChIKey | FBXUZWLIQHLVIM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|