C26H36ClN5O2S — CID 3998285
2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide (PubChem CID 3998285) has the molecular formula C26H36ClN5O2S and a molecular weight of 518.13 g/mol. Its IUPAC name is 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3998285 |
| Molecular Formula | C26H36ClN5O2S |
| Molecular Weight | 518.13 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide |
| SMILES | CCCCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)Nc3ccc(C)cc3)n2)CC1C |
| InChI | InChI=1S/C26H36ClN5O2S/c1-4-5-6-7-8-9-25(34)32-15-14-31(17-20(32)3)23-16-22(27)29-26(30-23)35-18-24(33)28-21-12-10-19(2)11-13-21/h10-13,16,20H,4-9,14-15,17-18H2,1-3H3,(H,28,33) |
| InChIKey | CFYWQHQYONQDER-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.13 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|