C24H33ClN6O2S — CID 42761619
N-butyl-4-[6-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazine-1-carboxamide (PubChem CID 42761619) has the molecular formula C24H33ClN6O2S and a molecular weight of 505.09 g/mol. Its IUPAC name is N-butyl-4-[6-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazine-1-carboxamide.
| Compound Name | N-butyl-4-[6-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42761619 |
| Molecular Formula | C24H33ClN6O2S |
| Molecular Weight | 505.09 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-butyl-4-[6-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)Nc3ccc(C)c(C)c3)n2)CC1C |
| InChI | InChI=1S/C24H33ClN6O2S/c1-5-6-9-26-24(33)31-11-10-30(14-18(31)4)21-13-20(25)28-23(29-21)34-15-22(32)27-19-8-7-16(2)17(3)12-19/h7-8,12-13,18H,5-6,9-11,14-15H2,1-4H3,(H,26,33)(H,27,32) |
| InChIKey | JZRKCGFNSNZCEF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.09 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|