C16H24ClN5O3S — CID 7238439
2-[4-[(3R)-4-(butylcarbamoyl)-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanylacetic acid (PubChem CID 7238439) has the molecular formula C16H24ClN5O3S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-[4-[(3R)-4-(butylcarbamoyl)-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-[(3R)-4-(butylcarbamoyl)-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 7238439 |
| Molecular Formula | C16H24ClN5O3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[4-[(3R)-4-(butylcarbamoyl)-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanylacetic acid |
| SMILES | CCCCNC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)O)n2)C[C@H]1C |
| InChI | InChI=1S/C16H24ClN5O3S/c1-3-4-5-18-16(25)22-7-6-21(9-11(22)2)13-8-12(17)19-15(20-13)26-10-14(23)24/h8,11H,3-7,9-10H2,1-2H3,(H,18,25)(H,23,24)/t11-/m1/s1 |
| InChIKey | CDCYLHVYSHPICJ-LLVKDONJSA-N |
| XLogP | 2.33 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|