C17H26ClN5O2S — CID 7337524
2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-butylacetamide (PubChem CID 7337524) has the molecular formula C17H26ClN5O2S and a molecular weight of 399.95 g/mol. Its IUPAC name is 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-butylacetamide.
| Compound Name | 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-butylacetamide |
|---|---|
| PubChem CID | 7337524 |
| Molecular Formula | C17H26ClN5O2S |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(C)=O)[C@H](C)C2)n1 |
| InChI | InChI=1S/C17H26ClN5O2S/c1-4-5-6-19-16(25)11-26-17-20-14(18)9-15(21-17)22-7-8-23(13(3)24)12(2)10-22/h9,12H,4-8,10-11H2,1-3H3,(H,19,25)/t12-/m1/s1 |
| InChIKey | JHDQPKJDBOZTQS-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|