C21H35ClN6O2S — CID 5181588
4-[6-chloro-2-[2-(hexylamino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methyl-N-propylpiperazine-1-carboxamide (PubChem CID 5181588) has the molecular formula C21H35ClN6O2S and a molecular weight of 471.07 g/mol. Its IUPAC name is 4-[6-chloro-2-[2-(hexylamino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methyl-N-propylpiperazine-1-carboxamide.
| Compound Name | 4-[6-chloro-2-[2-(hexylamino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methyl-N-propylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 5181588 |
| Molecular Formula | C21H35ClN6O2S |
| Molecular Weight | 471.07 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-[6-chloro-2-[2-(hexylamino)-2-oxoethyl]sulfanylpyrimidin-4-yl]-2-methyl-N-propylpiperazine-1-carboxamide |
| SMILES | CCCCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)NCCC)C(C)C2)n1 |
| InChI | InChI=1S/C21H35ClN6O2S/c1-4-6-7-8-10-23-19(29)15-31-20-25-17(22)13-18(26-20)27-11-12-28(16(3)14-27)21(30)24-9-5-2/h13,16H,4-12,14-15H2,1-3H3,(H,23,29)(H,24,30) |
| InChIKey | BIFKITHBERHNOB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.07 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|