C17H26ClN5O3S — CID 7249190
2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 7249190) has the molecular formula C17H26ClN5O3S and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 7249190 |
| Molecular Formula | C17H26ClN5O3S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[4-[(3R)-4-acetyl-3-methylpiperazin-1-yl]-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(C)=O)[C@H](C)C2)n1 |
| InChI | InChI=1S/C17H26ClN5O3S/c1-12-10-22(6-7-23(12)13(2)24)15-9-14(18)20-17(21-15)27-11-16(25)19-5-4-8-26-3/h9,12H,4-8,10-11H2,1-3H3,(H,19,25)/t12-/m1/s1 |
| InChIKey | GSXDUSXCPMZVEE-GFCCVEGCSA-N |
| XLogP | 1.43 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|