C22H28ClN5O3S — CID 5099978
2-[4-(4-benzoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 5099978) has the molecular formula C22H28ClN5O3S and a molecular weight of 478.02 g/mol. Its IUPAC name is 2-[4-(4-benzoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-(4-benzoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 5099978 |
| Molecular Formula | C22H28ClN5O3S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[4-(4-benzoyl-3-methylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)c3ccccc3)C(C)C2)n1 |
| InChI | InChI=1S/C22H28ClN5O3S/c1-16-14-27(10-11-28(16)21(30)17-7-4-3-5-8-17)19-13-18(23)25-22(26-19)32-15-20(29)24-9-6-12-31-2/h3-5,7-8,13,16H,6,9-12,14-15H2,1-2H3,(H,24,29) |
| InChIKey | URRMZHARPITKJA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|