C22H34ClN5O2S — CID 3963992
2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclopropylacetamide (PubChem CID 3963992) has the molecular formula C22H34ClN5O2S and a molecular weight of 468.07 g/mol. Its IUPAC name is 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclopropylacetamide.
| Compound Name | 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 3963992 |
| Molecular Formula | C22H34ClN5O2S |
| Molecular Weight | 468.07 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl-N-cyclopropylacetamide |
| SMILES | CCCCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)NC3CC3)n2)CC1C |
| InChI | InChI=1S/C22H34ClN5O2S/c1-3-4-5-6-7-8-21(30)28-12-11-27(14-16(28)2)19-13-18(23)25-22(26-19)31-15-20(29)24-17-9-10-17/h13,16-17H,3-12,14-15H2,1-2H3,(H,24,29) |
| InChIKey | OVEHZBWCNRGYKN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.07 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|