C23H38ClN5O2S — CID 4591057
N-butan-2-yl-2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 4591057) has the molecular formula C23H38ClN5O2S and a molecular weight of 484.11 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-butan-2-yl-2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4591057 |
| Molecular Formula | C23H38ClN5O2S |
| Molecular Weight | 484.11 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | N-butan-2-yl-2-[4-chloro-6-(3-methyl-4-octanoylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | CCCCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)NC(C)CC)n2)CC1C |
| InChI | InChI=1S/C23H38ClN5O2S/c1-5-7-8-9-10-11-22(31)29-13-12-28(15-18(29)4)20-14-19(24)26-23(27-20)32-16-21(30)25-17(3)6-2/h14,17-18H,5-13,15-16H2,1-4H3,(H,25,30) |
| InChIKey | IHQSQJPKTRNKMP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.11 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|