C33H42ClN5O2S — CID 98395982
2-[4-chloro-6-[(3S)-3-methyl-4-octanoylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[(1S)-1,2-diphenylethyl]acetamide (PubChem CID 98395982) has the molecular formula C33H42ClN5O2S and a molecular weight of 608.25 g/mol. Its IUPAC name is 2-[4-chloro-6-[(3S)-3-methyl-4-octanoylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[(1S)-1,2-diphenylethyl]acetamide.
| Compound Name | 2-[4-chloro-6-[(3S)-3-methyl-4-octanoylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[(1S)-1,2-diphenylethyl]acetamide |
|---|---|
| PubChem CID | 98395982 |
| Molecular Formula | C33H42ClN5O2S |
| Molecular Weight | 608.25 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 2-[4-chloro-6-[(3S)-3-methyl-4-octanoylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-[(1S)-1,2-diphenylethyl]acetamide |
| SMILES | CCCCCCCC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)N[C@@H](Cc3ccccc3)c3ccccc3)n2)C[C@@H]1C |
| InChI | InChI=1S/C33H42ClN5O2S/c1-3-4-5-6-13-18-32(41)39-20-19-38(23-25(39)2)30-22-29(34)36-33(37-30)42-24-31(40)35-28(27-16-11-8-12-17-27)21-26-14-9-7-10-15-26/h7-12,14-17,22,25,28H,3-6,13,18-21,23-24H2,1-2H3,(H,35,40)/t25-,28-/m0/s1 |
| InChIKey | OJOJMFVYYLFVIT-LSYYVWMOSA-N |
| XLogP | 6.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.25 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|