C18H18N4O2S — CID 18161950
2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 18161950) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18161950 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | COc1ccc(-n2ccnc2SCC(=O)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-24-16-7-5-15(6-8-16)22-11-10-20-18(22)25-13-17(23)21-12-14-4-2-3-9-19-14/h2-11H,12-13H2,1H3,(H,21,23) |
| InChIKey | KBAIHDMZEHBDJY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |