C25H22N4O3S — CID 41434287
2-[[2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide (PubChem CID 41434287) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-[[2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 41434287 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[[2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide |
| SMILES | COc1ccc(-n2ccnc2SCC(=O)Nc2ccccc2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N4O3S/c1-32-20-13-11-19(12-14-20)29-16-15-26-25(29)33-17-23(30)28-22-10-6-5-9-21(22)24(31)27-18-7-3-2-4-8-18/h2-16H,17H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | QPHCVWRUJJQJRC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |