C22H24N4O3S — CID 17434238
2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 17434238) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17434238 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(-n2ccnc2SCC(=O)Nc2ccccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H24N4O3S/c1-28-18-8-6-17(7-9-18)26-11-10-23-22(26)30-16-21(27)24-19-4-2-3-5-20(19)25-12-14-29-15-13-25/h2-11H,12-16H2,1H3,(H,24,27) |
| InChIKey | ADZDQYCEYDCHNX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |