C30H34N4O5S — CID 3957299
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanylacetamide (PubChem CID 3957299) has the molecular formula C30H34N4O5S and a molecular weight of 562.69 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3957299 |
| Molecular Formula | C30H34N4O5S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanylacetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CSc1nc2ccccc2n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H34N4O5S/c1-4-38-27-19-26(33-14-16-37-17-15-33)28(39-5-2)18-24(27)31-29(35)20-40-30-32-23-8-6-7-9-25(23)34(30)21-10-12-22(36-3)13-11-21/h6-13,18-19H,4-5,14-17,20H2,1-3H3,(H,31,35) |
| InChIKey | NGPNXMOYYUSYSN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|