C25H30N2O8 — CID 56506026
2-O-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 56506026) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-O-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 56506026 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-O-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)COC(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C25H30N2O8/c1-4-33-21-15-20(27-10-12-32-13-11-27)22(34-5-2)14-19(21)26-23(28)16-35-25(30)18-9-7-6-8-17(18)24(29)31-3/h6-9,14-15H,4-5,10-13,16H2,1-3H3,(H,26,28) |
| InChIKey | SCYKCOZADKIWQK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|