C23H31N3O7 — CID 4847472
[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 4847472) has the molecular formula C23H31N3O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4847472 |
| Molecular Formula | C23H31N3O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)COC(=O)c1c(CC)noc1C |
| InChI | InChI=1S/C23H31N3O7/c1-5-16-22(15(4)33-25-16)23(28)32-14-21(27)24-17-12-20(31-7-3)18(13-19(17)30-6-2)26-8-10-29-11-9-26/h12-13H,5-11,14H2,1-4H3,(H,24,27) |
| InChIKey | AYHTVWFNYBRNED-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|