C20H30N2O6S — CID 7952651
ethyl 2-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 7952651) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is ethyl 2-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7952651 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl 2-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(=O)Nc1cc(OCC)c(N2CCOCC2)cc1OCC |
| InChI | InChI=1S/C20H30N2O6S/c1-4-26-17-12-16(22-7-9-25-10-8-22)18(27-5-2)11-15(17)21-19(23)13-29-14-20(24)28-6-3/h11-12H,4-10,13-14H2,1-3H3,(H,21,23) |
| InChIKey | IEYSENNDRUDWKI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|