C20H26N4O4S — CID 3432332
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 3432332) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 3432332 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C20H26N4O4S/c1-3-27-17-13-16(24-8-10-26-11-9-24)18(28-4-2)12-15(17)23-19(25)14-29-20-21-6-5-7-22-20/h5-7,12-13H,3-4,8-11,14H2,1-2H3,(H,23,25) |
| InChIKey | BMVDFDFOKHDVSF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|