C23H38N3O4+ — CID 8875582
cyclopentyl-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]-dimethylazanium (PubChem CID 8875582) has the molecular formula C23H38N3O4+ and a molecular weight of 420.57 g/mol. Its IUPAC name is cyclopentyl-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]-dimethylazanium.
| Compound Name | cyclopentyl-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8875582 |
| Molecular Formula | C23H38N3O4+ |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | cyclopentyl-[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl]-dimethylazanium |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C[N+](C)(C)C1CCCC1 |
| InChI | InChI=1S/C23H37N3O4/c1-5-29-21-16-20(25-11-13-28-14-12-25)22(30-6-2)15-19(21)24-23(27)17-26(3,4)18-9-7-8-10-18/h15-16,18H,5-14,17H2,1-4H3/p+1 |
| InChIKey | HFFDEDPJBOAPTF-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|