C24H39N3O4 — CID 3447844
2-[cyclohexyl(ethyl)amino]-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide (PubChem CID 3447844) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-[cyclohexyl(ethyl)amino]-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[cyclohexyl(ethyl)amino]-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3447844 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 2-[cyclohexyl(ethyl)amino]-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CN(CC)C1CCCCC1 |
| InChI | InChI=1S/C24H39N3O4/c1-4-26(19-10-8-7-9-11-19)18-24(28)25-20-16-23(31-6-3)21(17-22(20)30-5-2)27-12-14-29-15-13-27/h16-17,19H,4-15,18H2,1-3H3,(H,25,28) |
| InChIKey | ZMEGNEXAMAMEIZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|