C23H37N3O4 — CID 9323693
(2S)-2-(azepan-1-yl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)propanamide (PubChem CID 9323693) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is (2S)-2-(azepan-1-yl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-(azepan-1-yl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 9323693 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (2S)-2-(azepan-1-yl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)propanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)[C@H](C)N1CCCCCC1 |
| InChI | InChI=1S/C23H37N3O4/c1-4-29-21-17-20(26-12-14-28-15-13-26)22(30-5-2)16-19(21)24-23(27)18(3)25-10-8-6-7-9-11-25/h16-18H,4-15H2,1-3H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | AFMBLIKULRZCCH-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|