C23H28F2N2O4S — CID 41204315
(2R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide (PubChem CID 41204315) has the molecular formula C23H28F2N2O4S and a molecular weight of 466.55 g/mol. Its IUPAC name is (2R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 41204315 |
| Molecular Formula | C23H28F2N2O4S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (2R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)[C@@H](C)Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H28F2N2O4S/c1-4-30-21-14-20(27-8-10-29-11-9-27)22(31-5-2)13-19(21)26-23(28)15(3)32-16-6-7-17(24)18(25)12-16/h6-7,12-15H,4-5,8-11H2,1-3H3,(H,26,28)/t15-/m1/s1 |
| InChIKey | LFIZRQPRKBXNRZ-OAHLLOKOSA-N |
| XLogP | 4.72 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|