C25H29N3O6 — CID 41056650
(2S)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 41056650) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is (2S)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 41056650 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (2S)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H29N3O6/c1-4-33-21-15-20(27-10-12-32-13-11-27)22(34-5-2)14-19(21)26-23(29)16(3)28-24(30)17-8-6-7-9-18(17)25(28)31/h6-9,14-16H,4-5,10-13H2,1-3H3,(H,26,29)/t16-/m0/s1 |
| InChIKey | XPEDBLZJUQHRQI-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|