C18H29N3O3S — CID 8627378
1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-propan-2-ylthiourea (PubChem CID 8627378) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-propan-2-ylthiourea.
| Compound Name | 1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 8627378 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-propan-2-ylthiourea |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=S)NC(C)C |
| InChI | InChI=1S/C18H29N3O3S/c1-5-23-16-12-15(21-7-9-22-10-8-21)17(24-6-2)11-14(16)20-18(25)19-13(3)4/h11-13H,5-10H2,1-4H3,(H2,19,20,25) |
| InChIKey | CEYLPDIEIBBQNF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|