C20H32N3O4+ — CID 7395843
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 7395843) has the molecular formula C20H32N3O4+ and a molecular weight of 378.49 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 7395843 |
| Molecular Formula | C20H32N3O4+ |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C[NH+]1CCCC1 |
| InChI | InChI=1S/C20H31N3O4/c1-3-26-18-14-17(23-9-11-25-12-10-23)19(27-4-2)13-16(18)21-20(24)15-22-7-5-6-8-22/h13-14H,3-12,15H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | VLVGVFYHJZVVNL-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|