C20H32N2O5 — CID 3508709
2-butoxy-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide (PubChem CID 3508709) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-butoxy-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-butoxy-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3508709 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-butoxy-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCCCOCC(=O)Nc1cc(OCC)c(N2CCOCC2)cc1OCC |
| InChI | InChI=1S/C20H32N2O5/c1-4-7-10-25-15-20(23)21-16-13-19(27-6-3)17(14-18(16)26-5-2)22-8-11-24-12-9-22/h13-14H,4-12,15H2,1-3H3,(H,21,23) |
| InChIKey | VKTOZWZVDTWPMH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|