C23H28N2O7 — CID 16539860
[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 16539860) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 16539860 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H28N2O7/c1-3-30-20-14-19(25-9-11-29-12-10-25)21(31-4-2)13-18(20)24-22(27)15-32-23(28)16-5-7-17(26)8-6-16/h5-8,13-14,26H,3-4,9-12,15H2,1-2H3,(H,24,27) |
| InChIKey | ZVJHRWBGPPIQBK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|