C22H29N3O7 — CID 4854269
[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 4854269) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4854269 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)COC(=O)c1c(C)noc1C |
| InChI | InChI=1S/C22H29N3O7/c1-5-29-18-12-17(25-7-9-28-10-8-25)19(30-6-2)11-16(18)23-20(26)13-31-22(27)21-14(3)24-32-15(21)4/h11-12H,5-10,13H2,1-4H3,(H,23,26) |
| InChIKey | OLAUDDYFXCTHKW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|